C22H50O7Si4 — CID 21037504
[1-propoxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] 2-methylprop-2-enoate (PubChem CID 21037504) has the molecular formula C22H50O7Si4 and a molecular weight of 538.98 g/mol. Its IUPAC name is [1-propoxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-propoxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21037504 |
| Molecular Formula | C22H50O7Si4 |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [1-propoxy-3-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COCCC)COCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H50O7Si4/c1-13-15-24-18-21(26-22(23)20(2)3)19-25-16-14-17-33(27-30(4,5)6,28-31(7,8)9)29-32(10,11)12/h21H,2,13-19H2,1,3-12H3 |
| InChIKey | FEAPOLWYXRZPNU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|