C25H52O10Si2 — CID 58695545
2,3-bis(3-triethoxysilylpropoxy)propyl 2-methylprop-2-enoate (PubChem CID 58695545) has the molecular formula C25H52O10Si2 and a molecular weight of 568.85 g/mol. Its IUPAC name is 2,3-bis(3-triethoxysilylpropoxy)propyl 2-methylprop-2-enoate.
| Compound Name | 2,3-bis(3-triethoxysilylpropoxy)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58695545 |
| Molecular Formula | C25H52O10Si2 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 2,3-bis(3-triethoxysilylpropoxy)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COCCC[Si](OCC)(OCC)OCC)OCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C25H52O10Si2/c1-9-30-36(31-10-2,32-11-3)19-15-17-27-21-24(22-29-25(26)23(7)8)28-18-16-20-37(33-12-4,34-13-5)35-14-6/h24H,7,9-22H2,1-6,8H3 |
| InChIKey | NUQIDACUZJLUEN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|