C19H38O7Si — CID 174676531
propyl 2-methylprop-2-enoate;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 174676531) has the molecular formula C19H38O7Si and a molecular weight of 406.59 g/mol. Its IUPAC name is propyl 2-methylprop-2-enoate;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | propyl 2-methylprop-2-enoate;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 174676531 |
| Molecular Formula | C19H38O7Si |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | propyl 2-methylprop-2-enoate;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C=C(C)C(=O)OCCC.CCO[Si](CCCOCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si.C7H12O2/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12;1-4-5-9-7(8)6(2)3/h12H,4-11H2,1-3H3;2,4-5H2,1,3H3 |
| InChIKey | PILODBCPFAMEPL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|