C28H58O9Si2 — CID 173321049
4-dimethoxysilylbutyl 2-methylprop-2-enoate;tris[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 173321049) has the molecular formula C28H58O9Si2 and a molecular weight of 594.94 g/mol. Its IUPAC name is 4-dimethoxysilylbutyl 2-methylprop-2-enoate;tris[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | 4-dimethoxysilylbutyl 2-methylprop-2-enoate;tris[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 173321049 |
| Molecular Formula | C28H58O9Si2 |
| Molecular Weight | 594.94 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | 4-dimethoxysilylbutyl 2-methylprop-2-enoate;tris[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C=C(C)C(=O)OCCCC[SiH](OC)OC.CC(C)(C)O[Si](CCCOCC1CO1)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C18H38O5Si.C10H20O4Si/c1-16(2,3)21-24(22-17(4,5)6,23-18(7,8)9)12-10-11-19-13-15-14-20-15;1-9(2)10(11)14-7-5-6-8-15(12-3)13-4/h15H,10-14H2,1-9H3;15H,1,5-8H2,2-4H3 |
| InChIKey | VRNXDGAKZSKUEN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|