C15H32O4Si — CID 139759531
methyl-bis[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 139759531) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is methyl-bis[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | methyl-bis[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 139759531 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | methyl-bis[(2-methylpropan-2-yl)oxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CC(C)(C)O[Si](C)(CCCOCC1CO1)OC(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-14(2,3)18-20(7,19-15(4,5)6)10-8-9-16-11-13-12-17-13/h13H,8-12H2,1-7H3 |
| InChIKey | UQSWIDYXDCJEJD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|