C11H20O6Si — CID 22292670
[acetyloxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] acetate (PubChem CID 22292670) has the molecular formula C11H20O6Si and a molecular weight of 276.36 g/mol. Its IUPAC name is [acetyloxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] acetate.
| Compound Name | [acetyloxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] acetate |
|---|---|
| PubChem CID | 22292670 |
| Molecular Formula | C11H20O6Si |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [acetyloxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] acetate |
| SMILES | CC(=O)O[Si](C)(CCCOCC1CO1)OC(C)=O |
| InChI | InChI=1S/C11H20O6Si/c1-9(12)16-18(3,17-10(2)13)6-4-5-14-7-11-8-15-11/h11H,4-8H2,1-3H3 |
| InChIKey | GBNAEQPSFBMCIK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|