C13H28O6Si — CID 174775957
butan-2-one;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 174775957) has the molecular formula C13H28O6Si and a molecular weight of 308.45 g/mol. Its IUPAC name is butan-2-one;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | butan-2-one;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 174775957 |
| Molecular Formula | C13H28O6Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | butan-2-one;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCC(C)=O.CO[Si](CCCOCC1CO1)(OC)OC |
| InChI | InChI=1S/C9H20O5Si.C4H8O/c1-10-15(11-2,12-3)6-4-5-13-7-9-8-14-9;1-3-4(2)5/h9H,4-8H2,1-3H3;3H2,1-2H3 |
| InChIKey | CWMBGMMPABMSTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|