C12H28O7Si2 — CID 159211950
oxiran-2-ylmethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 159211950) has the molecular formula C12H28O7Si2 and a molecular weight of 340.52 g/mol. Its IUPAC name is oxiran-2-ylmethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | oxiran-2-ylmethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 159211950 |
| Molecular Formula | C12H28O7Si2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | oxiran-2-ylmethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC.[SiH3]OCC1CO1 |
| InChI | InChI=1S/C9H20O5Si.C3H8O2Si/c1-10-15(11-2,12-3)6-4-5-13-7-9-8-14-9;6-5-2-3-1-4-3/h9H,4-8H2,1-3H3;3H,1-2H2,6H3 |
| InChIKey | KQPFFYJXPOGECR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|