C11H24O7Si — CID 87722976
2-[2-hydroxyethoxy-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxyethanol (PubChem CID 87722976) has the molecular formula C11H24O7Si and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxyethanol.
| Compound Name | 2-[2-hydroxyethoxy-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxyethanol |
|---|---|
| PubChem CID | 87722976 |
| Molecular Formula | C11H24O7Si |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[2-hydroxyethoxy-methoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxyethanol |
| SMILES | CO[Si](CCCOCC1CO1)(OCCO)OCCO |
| InChI | InChI=1S/C11H24O7Si/c1-14-19(17-6-3-12,18-7-4-13)8-2-5-15-9-11-10-16-11/h11-13H,2-10H2,1H3 |
| InChIKey | REKOMSBVVLPHBE-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|