C15H34O8Si — CID 174916618
propane-1,2,3-triol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 174916618) has the molecular formula C15H34O8Si and a molecular weight of 370.52 g/mol. Its IUPAC name is propane-1,2,3-triol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | propane-1,2,3-triol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 174916618 |
| Molecular Formula | C15H34O8Si |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | propane-1,2,3-triol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[Si](CCCOCC1CO1)(OCC)OCC.OCC(O)CO |
| InChI | InChI=1S/C12H26O5Si.C3H8O3/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12;4-1-3(6)2-5/h12H,4-11H2,1-3H3;3-6H,1-2H2 |
| InChIKey | FSBWNHYHIGBZEH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|