C23H50O9Si2 — CID 87666631
diethoxy-methyl-[1-(oxiran-2-ylmethoxy)propyl]silane;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 87666631) has the molecular formula C23H50O9Si2 and a molecular weight of 526.82 g/mol. Its IUPAC name is diethoxy-methyl-[1-(oxiran-2-ylmethoxy)propyl]silane;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | diethoxy-methyl-[1-(oxiran-2-ylmethoxy)propyl]silane;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 87666631 |
| Molecular Formula | C23H50O9Si2 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | diethoxy-methyl-[1-(oxiran-2-ylmethoxy)propyl]silane;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[Si](C)(OCC)C(CC)OCC1CO1.CCO[Si](CCCOCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si.C11H24O4Si/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12;1-5-11(13-9-10-8-12-10)16(4,14-6-2)15-7-3/h12H,4-11H2,1-3H3;10-11H,5-9H2,1-4H3 |
| InChIKey | PUMCRDLXPYXFIF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|