C15H34O5SSi — CID 174889951
propane-1-thiol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 174889951) has the molecular formula C15H34O5SSi and a molecular weight of 354.59 g/mol. Its IUPAC name is propane-1-thiol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | propane-1-thiol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 174889951 |
| Molecular Formula | C15H34O5SSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | propane-1-thiol;triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCCS.CCO[Si](CCCOCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si.C3H8S/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12;1-2-3-4/h12H,4-11H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | PUNMPLZWVNGXSM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|