C11H28O6Si2 — CID 161088311
ethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 161088311) has the molecular formula C11H28O6Si2 and a molecular weight of 312.51 g/mol. Its IUPAC name is ethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | ethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 161088311 |
| Molecular Formula | C11H28O6Si2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethoxysilane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[SiH3].CO[Si](CCCOCC1CO1)(OC)OC |
| InChI | InChI=1S/C9H20O5Si.C2H8OSi/c1-10-15(11-2,12-3)6-4-5-13-7-9-8-14-9;1-2-3-4/h9H,4-8H2,1-3H3;2H2,1,4H3 |
| InChIKey | UGVBZGUEZKFNIH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|