C21H40O8Si2 — CID 87370600
triethoxy(phenyl)silane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 87370600) has the molecular formula C21H40O8Si2 and a molecular weight of 476.72 g/mol. Its IUPAC name is triethoxy(phenyl)silane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | triethoxy(phenyl)silane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 87370600 |
| Molecular Formula | C21H40O8Si2 |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | triethoxy(phenyl)silane;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1.CO[Si](CCCOCC1CO1)(OC)OC |
| InChI | InChI=1S/C12H20O3Si.C9H20O5Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;1-10-15(11-2,12-3)6-4-5-13-7-9-8-14-9/h7-11H,4-6H2,1-3H3;9H,4-8H2,1-3H3 |
| InChIKey | JPVHAIPWNPQFDD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|