C33H56O13Si5 — CID 58498512
[dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-[[[dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-ethenyl-methoxysilane (PubChem CID 58498512) has the molecular formula C33H56O13Si5 and a molecular weight of 801.23 g/mol. Its IUPAC name is [dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-[[[dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-ethenyl-methoxysilane.
| Compound Name | [dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-[[[dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-ethenyl-methoxysilane |
|---|---|
| PubChem CID | 58498512 |
| Molecular Formula | C33H56O13Si5 |
| Molecular Weight | 801.23 g/mol |
| Exact Mass | 800.26 |
| IUPAC Name | [dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-[[[dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-ethenyl-methoxysilane |
| SMILES | C=C[Si](OC)(O[Si](CCCOCC1CO1)(OC)OC)O[Si](O[Si](C)(C)O[Si](CCCOCC1CO1)(OC)OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H56O13Si5/c1-9-48(34-2,45-50(37-5,38-6)25-17-23-40-27-31-29-42-31)46-51(32-18-12-10-13-19-32,33-20-14-11-15-21-33)44-47(7,8)43-49(35-3,36-4)24-16-22-39-26-30-28-41-30/h9-15,18-21,30-31H,1,16-17,22-29H2,2-8H3 |
| InChIKey | UMYYDULGWQBKHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 126.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|