C13H20O3Si — CID 101402997
hydroxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane (PubChem CID 101402997) has the molecular formula C13H20O3Si and a molecular weight of 252.39 g/mol. Its IUPAC name is hydroxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane.
| Compound Name | hydroxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane |
|---|---|
| PubChem CID | 101402997 |
| Molecular Formula | C13H20O3Si |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | hydroxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane |
| SMILES | C[Si](O)(CCCOCC1CO1)c1ccccc1 |
| InChI | InChI=1S/C13H20O3Si/c1-17(14,13-6-3-2-4-7-13)9-5-8-15-10-12-11-16-12/h2-4,6-7,12,14H,5,8-11H2,1H3 |
| InChIKey | QXACUVLXQLDOQO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|