C39H67FO5Si4 — CID 162446231
1,7-bis[[4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethylsilyl]-4-fluoroheptan-4-ol (PubChem CID 162446231) has the molecular formula C39H67FO5Si4 and a molecular weight of 747.30 g/mol. Its IUPAC name is 1,7-bis[[4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethylsilyl]-4-fluoroheptan-4-ol.
| Compound Name | 1,7-bis[[4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethylsilyl]-4-fluoroheptan-4-ol |
|---|---|
| PubChem CID | 162446231 |
| Molecular Formula | C39H67FO5Si4 |
| Molecular Weight | 747.30 g/mol |
| Exact Mass | 746.40 |
| IUPAC Name | 1,7-bis[[4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethylsilyl]-4-fluoroheptan-4-ol |
| SMILES | C[Si](C)(CCCOCC1CO1)c1ccc([Si](C)(C)CCCC(O)(F)CCC[Si](C)(C)c2ccc([Si](C)(C)CCCOCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C39H67FO5Si4/c1-46(2,35-13-17-37(18-14-35)48(5,6)27-11-23-42-29-33-31-44-33)25-9-21-39(40,41)22-10-26-47(3,4)36-15-19-38(20-16-36)49(7,8)28-12-24-43-30-34-32-45-34/h13-20,33-34,41H,9-12,21-32H2,1-8H3 |
| InChIKey | CWMHVWGQJJZYAC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.30 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|