C16H30O4Si2 — CID 157211120
diethoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane;silane (PubChem CID 157211120) has the molecular formula C16H30O4Si2 and a molecular weight of 342.58 g/mol. Its IUPAC name is diethoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane;silane.
| Compound Name | diethoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane;silane |
|---|---|
| PubChem CID | 157211120 |
| Molecular Formula | C16H30O4Si2 |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | diethoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane;silane |
| SMILES | CCO[Si](CCCOCC1CO1)(OCC)c1ccccc1.[SiH4] |
| InChI | InChI=1S/C16H26O4Si.H4Si/c1-3-19-21(20-4-2,16-9-6-5-7-10-16)12-8-11-17-13-15-14-18-15;/h5-7,9-10,15H,3-4,8,11-14H2,1-2H3;1H4 |
| InChIKey | ARWYNGSNMMKKPE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|