C23H30O4Si — CID 151390772
diethoxy-(9H-fluoren-1-yl)-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 151390772) has the molecular formula C23H30O4Si and a molecular weight of 398.58 g/mol. Its IUPAC name is diethoxy-(9H-fluoren-1-yl)-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | diethoxy-(9H-fluoren-1-yl)-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 151390772 |
| Molecular Formula | C23H30O4Si |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | diethoxy-(9H-fluoren-1-yl)-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[Si](CCCOCC1CO1)(OCC)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C23H30O4Si/c1-3-26-28(27-4-2,14-8-13-24-16-19-17-25-19)23-12-7-11-21-20-10-6-5-9-18(20)15-22(21)23/h5-7,9-12,19H,3-4,8,13-17H2,1-2H3 |
| InChIKey | OUJVTBMXOHTWFT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|