C15H24O2Si — CID 141423011
trimethyl-[2-[3-(oxiran-2-ylmethoxy)propyl]phenyl]silane (PubChem CID 141423011) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is trimethyl-[2-[3-(oxiran-2-ylmethoxy)propyl]phenyl]silane.
| Compound Name | trimethyl-[2-[3-(oxiran-2-ylmethoxy)propyl]phenyl]silane |
|---|---|
| PubChem CID | 141423011 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | trimethyl-[2-[3-(oxiran-2-ylmethoxy)propyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccccc1CCCOCC1CO1 |
| InChI | InChI=1S/C15H24O2Si/c1-18(2,3)15-9-5-4-7-13(15)8-6-10-16-11-14-12-17-14/h4-5,7,9,14H,6,8,10-12H2,1-3H3 |
| InChIKey | JKTLOWCVUWAQJO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|