C18H34O6 — CID 130476668
2-[4-[4-[4-(oxiran-2-ylmethoxy)butoxy]butoxy]butoxymethyl]oxirane (PubChem CID 130476668) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-[4-[4-[4-(oxiran-2-ylmethoxy)butoxy]butoxy]butoxymethyl]oxirane.
| Compound Name | 2-[4-[4-[4-(oxiran-2-ylmethoxy)butoxy]butoxy]butoxymethyl]oxirane |
|---|---|
| PubChem CID | 130476668 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-[4-[4-[4-(oxiran-2-ylmethoxy)butoxy]butoxy]butoxymethyl]oxirane |
| SMILES | C(CCOCCCCOCC1CO1)COCCCCOCC1CO1 |
| InChI | InChI=1S/C18H34O6/c1(7-19-9-3-5-11-21-13-17-15-23-17)2-8-20-10-4-6-12-22-14-18-16-24-18/h17-18H,1-16H2 |
| InChIKey | GFYKOANTXLJBSW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|