C17H32O3 — CID 141065543
2-[12-(oxiran-2-yl)dodecoxymethyl]oxirane (PubChem CID 141065543) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[12-(oxiran-2-yl)dodecoxymethyl]oxirane.
| Compound Name | 2-[12-(oxiran-2-yl)dodecoxymethyl]oxirane |
|---|---|
| PubChem CID | 141065543 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 2-[12-(oxiran-2-yl)dodecoxymethyl]oxirane |
| SMILES | C(CCCCCCC1CO1)CCCCCOCC1CO1 |
| InChI | InChI=1S/C17H32O3/c1(3-5-7-9-11-16-14-19-16)2-4-6-8-10-12-18-13-17-15-20-17/h16-17H,1-15H2 |
| InChIKey | PFHIZNGXYXGPKV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|