About 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane
1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 88512513) has the molecular formula C23H38O4
and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 88512513 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCCCCCCCCc1ccccc1OCC |
| InChI | InChI=1S/C17H28O.C6H10O3/c1-3-5-6-7-8-9-10-13-16-14-11-12-15-17(16)18-4-2;1(5-3-8-5)7-2-6-4-9-6/h11-12,14-15H,3-10,13H2,1-2H3;5-6H,1-4H2 |
| InChIKey | GNJMUQNQGXVIHG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 88512513) is 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CCCCCCCCCc1ccccc1OCC.
What is the InChIKey of 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is GNJMUQNQGXVIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O.C6H10O3/c1-3-5-6-7-8-9-10-13-16-14-11-12-15-17(16)18-4-2;1(5-3-8-5)7-2-6-4-9-6/h11-12,14-15H,3-10,13H2,1-2H3;5-6H,1-4H2.
What are the key properties of 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 378.55 g/mol, XLogP of 5.18, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-nonylbenzene;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 88512513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).