C23H40O6 — CID 88792258
ethane-1,2-diol;2-nonylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 88792258) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is ethane-1,2-diol;2-nonylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | ethane-1,2-diol;2-nonylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 88792258 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethane-1,2-diol;2-nonylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCCCCCCCCc1ccccc1O.OCCO |
| InChI | InChI=1S/C15H24O.C6H10O3.C2H6O2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1(5-3-8-5)7-2-6-4-9-6;3-1-2-4/h9-10,12-13,16H,2-8,11H2,1H3;5-6H,1-4H2;3-4H,1-2H2 |
| InChIKey | YASYJJHMVKHKSY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|