About 2-octylphenol;tungsten
2-octylphenol;tungsten (PubChem CID 157237523) has the molecular formula C14H22OW
and a molecular weight of 390.17 g/mol. Its IUPAC name is 2-octylphenol;tungsten.
Molecular Properties
| Compound Name | 2-octylphenol;tungsten |
| PubChem CID | 157237523 |
| Molecular Formula | C14H22OW |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-octylphenol;tungsten |
| SMILES | CCCCCCCCc1ccccc1O.[W] |
| InChI | InChI=1S/C14H22O.W/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;/h8-9,11-12,15H,2-7,10H2,1H3; |
| InChIKey | AUUVJHTZAHJATM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylphenol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylphenol;tungsten?
The IUPAC name of 2-octylphenol;tungsten (CID 157237523) is 2-octylphenol;tungsten.
What is the SMILES notation for 2-octylphenol;tungsten?
The canonical SMILES for 2-octylphenol;tungsten is CCCCCCCCc1ccccc1O.[W].
What is the InChIKey of 2-octylphenol;tungsten?
The InChIKey is AUUVJHTZAHJATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.W/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;/h8-9,11-12,15H,2-7,10H2,1H3;.
What are the key properties of 2-octylphenol;tungsten?
2-octylphenol;tungsten has a molecular weight of 390.17 g/mol, XLogP of 4.29, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylphenol;tungsten is sourced from PubChem (CID 157237523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).