About lithium;2-dodecylphenol;hydride
lithium;2-dodecylphenol;hydride (PubChem CID 174657819) has the molecular formula C18H31LiO
and a molecular weight of 270.39 g/mol. Its IUPAC name is lithium;2-dodecylphenol;hydride.
Molecular Properties
| Compound Name | lithium;2-dodecylphenol;hydride |
| PubChem CID | 174657819 |
| Molecular Formula | C18H31LiO |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.25 |
| IUPAC Name | lithium;2-dodecylphenol;hydride |
| SMILES | CCCCCCCCCCCCc1ccccc1O.[H-].[Li+] |
| InChI | InChI=1S/C18H30O.Li.H/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19;;/h12-13,15-16,19H,2-11,14H2,1H3;;/q;+1;-1 |
| InChIKey | KPJUERFUFFBYIJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-dodecylphenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-dodecylphenol;hydride?
The IUPAC name of lithium;2-dodecylphenol;hydride (CID 174657819) is lithium;2-dodecylphenol;hydride.
What is the SMILES notation for lithium;2-dodecylphenol;hydride?
The canonical SMILES for lithium;2-dodecylphenol;hydride is CCCCCCCCCCCCc1ccccc1O.[H-].[Li+].
What is the InChIKey of lithium;2-dodecylphenol;hydride?
The InChIKey is KPJUERFUFFBYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O.Li.H/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19;;/h12-13,15-16,19H,2-11,14H2,1H3;;/q;+1;-1.
What are the key properties of lithium;2-dodecylphenol;hydride?
lithium;2-dodecylphenol;hydride has a molecular weight of 270.39 g/mol, XLogP of 2.97, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-dodecylphenol;hydride is sourced from PubChem (CID 174657819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).