About ethene;2-nonylphenol
ethene;2-nonylphenol (PubChem CID 66616289) has the molecular formula C23H40O
and a molecular weight of 332.57 g/mol. Its IUPAC name is ethene;2-nonylphenol.
Molecular Properties
| Compound Name | ethene;2-nonylphenol |
| PubChem CID | 66616289 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | ethene;2-nonylphenol |
| SMILES | C=C.C=C.C=C.C=C.CCCCCCCCCc1ccccc1O |
| InChI | InChI=1S/C15H24O.4C2H4/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;4*1-2/h9-10,12-13,16H,2-8,11H2,1H3;4*1-2H2 |
| InChIKey | VJGOZWTWFJRBIB-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-nonylphenol?
The IUPAC name of ethene;2-nonylphenol (CID 66616289) is ethene;2-nonylphenol.
What is the SMILES notation for ethene;2-nonylphenol?
The canonical SMILES for ethene;2-nonylphenol is C=C.C=C.C=C.C=C.CCCCCCCCCc1ccccc1O.
What is the InChIKey of ethene;2-nonylphenol?
The InChIKey is VJGOZWTWFJRBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.4C2H4/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;4*1-2/h9-10,12-13,16H,2-8,11H2,1H3;4*1-2H2.
What are the key properties of ethene;2-nonylphenol?
ethene;2-nonylphenol has a molecular weight of 332.57 g/mol, XLogP of 7.89, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-nonylphenol is sourced from PubChem (CID 66616289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).