About 2-decylphenol;hydrazine
2-decylphenol;hydrazine (PubChem CID 159983030) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-decylphenol;hydrazine.
Molecular Properties
| Compound Name | 2-decylphenol;hydrazine |
| PubChem CID | 159983030 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-decylphenol;hydrazine |
| SMILES | CCCCCCCCCCc1ccccc1O.NN |
| InChI | InChI=1S/C16H26O.H4N2/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17;1-2/h10-11,13-14,17H,2-9,12H2,1H3;1-2H2 |
| InChIKey | OFZZRYSQLLDBNS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-decylphenol;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decylphenol;hydrazine?
The IUPAC name of 2-decylphenol;hydrazine (CID 159983030) is 2-decylphenol;hydrazine.
What is the SMILES notation for 2-decylphenol;hydrazine?
The canonical SMILES for 2-decylphenol;hydrazine is CCCCCCCCCCc1ccccc1O.NN.
What is the InChIKey of 2-decylphenol;hydrazine?
The InChIKey is OFZZRYSQLLDBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O.H4N2/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17;1-2/h10-11,13-14,17H,2-9,12H2,1H3;1-2H2.
What are the key properties of 2-decylphenol;hydrazine?
2-decylphenol;hydrazine has a molecular weight of 266.43 g/mol, XLogP of 3.89, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decylphenol;hydrazine is sourced from PubChem (CID 159983030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).