About formaldehyde;2-octadecylphenol
formaldehyde;2-octadecylphenol (PubChem CID 67830879) has the molecular formula C25H44O2
and a molecular weight of 376.63 g/mol. Its IUPAC name is formaldehyde;2-octadecylphenol.
Molecular Properties
| Compound Name | formaldehyde;2-octadecylphenol |
| PubChem CID | 67830879 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | formaldehyde;2-octadecylphenol |
| SMILES | C=O.CCCCCCCCCCCCCCCCCCc1ccccc1O |
| InChI | InChI=1S/C24H42O.CH2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-21-18-19-22-24(23)25;1-2/h18-19,21-22,25H,2-17,20H2,1H3;1H2 |
| InChIKey | ORNJMWMYGFDYFG-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-octadecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-octadecylphenol?
The IUPAC name of formaldehyde;2-octadecylphenol (CID 67830879) is formaldehyde;2-octadecylphenol.
What is the SMILES notation for formaldehyde;2-octadecylphenol?
The canonical SMILES for formaldehyde;2-octadecylphenol is C=O.CCCCCCCCCCCCCCCCCCc1ccccc1O.
What is the InChIKey of formaldehyde;2-octadecylphenol?
The InChIKey is ORNJMWMYGFDYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O.CH2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-21-18-19-22-24(23)25;1-2/h18-19,21-22,25H,2-17,20H2,1H3;1H2.
What are the key properties of formaldehyde;2-octadecylphenol?
formaldehyde;2-octadecylphenol has a molecular weight of 376.63 g/mol, XLogP of 8.01, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-octadecylphenol is sourced from PubChem (CID 67830879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).