About 2-nonylphenol;oxaldehyde
2-nonylphenol;oxaldehyde (PubChem CID 18943315) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-nonylphenol;oxaldehyde.
Molecular Properties
| Compound Name | 2-nonylphenol;oxaldehyde |
| PubChem CID | 18943315 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-nonylphenol;oxaldehyde |
| SMILES | CCCCCCCCCc1ccccc1O.O=CC=O |
| InChI | InChI=1S/C15H24O.C2H2O2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;3-1-2-4/h9-10,12-13,16H,2-8,11H2,1H3;1-2H |
| InChIKey | VZIAKZLSAZKOAK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-nonylphenol;oxaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonylphenol;oxaldehyde?
The IUPAC name of 2-nonylphenol;oxaldehyde (CID 18943315) is 2-nonylphenol;oxaldehyde.
What is the SMILES notation for 2-nonylphenol;oxaldehyde?
The canonical SMILES for 2-nonylphenol;oxaldehyde is CCCCCCCCCc1ccccc1O.O=CC=O.
What is the InChIKey of 2-nonylphenol;oxaldehyde?
The InChIKey is VZIAKZLSAZKOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C2H2O2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;3-1-2-4/h9-10,12-13,16H,2-8,11H2,1H3;1-2H.
What are the key properties of 2-nonylphenol;oxaldehyde?
2-nonylphenol;oxaldehyde has a molecular weight of 278.39 g/mol, XLogP of 4.07, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylphenol;oxaldehyde is sourced from PubChem (CID 18943315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).