About formaldehyde;2-nonylphenol;2-octylphenol
formaldehyde;2-nonylphenol;2-octylphenol (PubChem CID 175344349) has the molecular formula C30H48O3
and a molecular weight of 456.71 g/mol. Its IUPAC name is formaldehyde;2-nonylphenol;2-octylphenol.
Molecular Properties
| Compound Name | formaldehyde;2-nonylphenol;2-octylphenol |
| PubChem CID | 175344349 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | formaldehyde;2-nonylphenol;2-octylphenol |
| SMILES | C=O.CCCCCCCCCc1ccccc1O.CCCCCCCCc1ccccc1O |
| InChI | InChI=1S/C15H24O.C14H22O.CH2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-2/h9-10,12-13,16H,2-8,11H2,1H3;8-9,11-12,15H,2-7,10H2,1H3;1H2 |
| InChIKey | DPHISZCIWRIPLW-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-nonylphenol;2-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-nonylphenol;2-octylphenol?
The IUPAC name of formaldehyde;2-nonylphenol;2-octylphenol (CID 175344349) is formaldehyde;2-nonylphenol;2-octylphenol.
What is the SMILES notation for formaldehyde;2-nonylphenol;2-octylphenol?
The canonical SMILES for formaldehyde;2-nonylphenol;2-octylphenol is C=O.CCCCCCCCCc1ccccc1O.CCCCCCCCc1ccccc1O.
What is the InChIKey of formaldehyde;2-nonylphenol;2-octylphenol?
The InChIKey is DPHISZCIWRIPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C14H22O.CH2O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-2/h9-10,12-13,16H,2-8,11H2,1H3;8-9,11-12,15H,2-7,10H2,1H3;1H2.
What are the key properties of formaldehyde;2-nonylphenol;2-octylphenol?
formaldehyde;2-nonylphenol;2-octylphenol has a molecular weight of 456.71 g/mol, XLogP of 8.80, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-nonylphenol;2-octylphenol is sourced from PubChem (CID 175344349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).