About 2-dodecylphenol;phosphoric acid
2-dodecylphenol;phosphoric acid (PubChem CID 67396083) has the molecular formula C18H33O5P
and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-dodecylphenol;phosphoric acid.
Molecular Properties
| Compound Name | 2-dodecylphenol;phosphoric acid |
| PubChem CID | 67396083 |
| Molecular Formula | C18H33O5P |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-dodecylphenol;phosphoric acid |
| SMILES | CCCCCCCCCCCCc1ccccc1O.O=P(O)(O)O |
| InChI | InChI=1S/C18H30O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19;1-5(2,3)4/h12-13,15-16,19H,2-11,14H2,1H3;(H3,1,2,3,4) |
| InChIKey | LAGMWBCXKYSRAL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecylphenol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecylphenol;phosphoric acid?
The IUPAC name of 2-dodecylphenol;phosphoric acid (CID 67396083) is 2-dodecylphenol;phosphoric acid.
What is the SMILES notation for 2-dodecylphenol;phosphoric acid?
The canonical SMILES for 2-dodecylphenol;phosphoric acid is CCCCCCCCCCCCc1ccccc1O.O=P(O)(O)O.
What is the InChIKey of 2-dodecylphenol;phosphoric acid?
The InChIKey is LAGMWBCXKYSRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19;1-5(2,3)4/h12-13,15-16,19H,2-11,14H2,1H3;(H3,1,2,3,4).
What are the key properties of 2-dodecylphenol;phosphoric acid?
2-dodecylphenol;phosphoric acid has a molecular weight of 360.43 g/mol, XLogP of 4.93, 11 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecylphenol;phosphoric acid is sourced from PubChem (CID 67396083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).