About 2-nonylphenol;pentan-1-ol
2-nonylphenol;pentan-1-ol (PubChem CID 70367302) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-nonylphenol;pentan-1-ol.
Molecular Properties
| Compound Name | 2-nonylphenol;pentan-1-ol |
| PubChem CID | 70367302 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-nonylphenol;pentan-1-ol |
| SMILES | CCCCCCCCCc1ccccc1O.CCCCCO |
| InChI | InChI=1S/C15H24O.C5H12O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-2-3-4-5-6/h9-10,12-13,16H,2-8,11H2,1H3;6H,2-5H2,1H3 |
| InChIKey | OYODVUJFOZFVNH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonylphenol;pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonylphenol;pentan-1-ol?
The IUPAC name of 2-nonylphenol;pentan-1-ol (CID 70367302) is 2-nonylphenol;pentan-1-ol.
What is the SMILES notation for 2-nonylphenol;pentan-1-ol?
The canonical SMILES for 2-nonylphenol;pentan-1-ol is CCCCCCCCCc1ccccc1O.CCCCCO.
What is the InChIKey of 2-nonylphenol;pentan-1-ol?
The InChIKey is OYODVUJFOZFVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C5H12O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-2-3-4-5-6/h9-10,12-13,16H,2-8,11H2,1H3;6H,2-5H2,1H3.
What are the key properties of 2-nonylphenol;pentan-1-ol?
2-nonylphenol;pentan-1-ol has a molecular weight of 308.51 g/mol, XLogP of 5.85, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylphenol;pentan-1-ol is sourced from PubChem (CID 70367302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).