About ethoxyethane;2-octylphenol
ethoxyethane;2-octylphenol (PubChem CID 66605620) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is ethoxyethane;2-octylphenol.
Molecular Properties
| Compound Name | ethoxyethane;2-octylphenol |
| PubChem CID | 66605620 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | ethoxyethane;2-octylphenol |
| SMILES | CCCCCCCCc1ccccc1O.CCOCC |
| InChI | InChI=1S/C14H22O.C4H10O/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-3-5-4-2/h8-9,11-12,15H,2-7,10H2,1H3;3-4H2,1-2H3 |
| InChIKey | RAUIDPSRWGVMGE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;2-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-octylphenol?
The IUPAC name of ethoxyethane;2-octylphenol (CID 66605620) is ethoxyethane;2-octylphenol.
What is the SMILES notation for ethoxyethane;2-octylphenol?
The canonical SMILES for ethoxyethane;2-octylphenol is CCCCCCCCc1ccccc1O.CCOCC.
What is the InChIKey of ethoxyethane;2-octylphenol?
The InChIKey is RAUIDPSRWGVMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C4H10O/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-3-5-4-2/h8-9,11-12,15H,2-7,10H2,1H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-octylphenol?
ethoxyethane;2-octylphenol has a molecular weight of 280.45 g/mol, XLogP of 5.34, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-octylphenol is sourced from PubChem (CID 66605620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).