C18H38O5 — CID 174849924
hexane;hexane-1,6-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174849924) has the molecular formula C18H38O5 and a molecular weight of 334.50 g/mol. Its IUPAC name is hexane;hexane-1,6-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | hexane;hexane-1,6-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174849924 |
| Molecular Formula | C18H38O5 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | hexane;hexane-1,6-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCCCCC.OCCCCCCO |
| InChI | InChI=1S/C6H10O3.C6H14O2.C6H14/c1(5-3-8-5)7-2-6-4-9-6;7-5-3-1-2-4-6-8;1-3-5-6-4-2/h5-6H,1-4H2;7-8H,1-6H2;3-6H2,1-2H3 |
| InChIKey | KXKSFSJLWCAGGF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|