C18H34O8 — CID 174983499
hexane-1,6-diol;bis(2-(oxiran-2-ylmethoxymethyl)oxirane) (PubChem CID 174983499) has the molecular formula C18H34O8 and a molecular weight of 378.46 g/mol. Its IUPAC name is hexane-1,6-diol;bis(2-(oxiran-2-ylmethoxymethyl)oxirane).
| Compound Name | hexane-1,6-diol;bis(2-(oxiran-2-ylmethoxymethyl)oxirane) |
|---|---|
| PubChem CID | 174983499 |
| Molecular Formula | C18H34O8 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | hexane-1,6-diol;bis(2-(oxiran-2-ylmethoxymethyl)oxirane) |
| SMILES | C(OCC1CO1)C1CO1.C(OCC1CO1)C1CO1.OCCCCCCO |
| InChI | InChI=1S/2C6H10O3.C6H14O2/c2*1(5-3-8-5)7-2-6-4-9-6;7-5-3-1-2-4-6-8/h2*5-6H,1-4H2;7-8H,1-6H2 |
| InChIKey | DJUCHUULSMVMMJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|