C18H36O5 — CID 173313374
ethane-1,2-diol;ethene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 173313374) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is ethane-1,2-diol;ethene;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | ethane-1,2-diol;ethene;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 173313374 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | ethane-1,2-diol;ethene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C=C.C=C.C=C.C=C.C=C.OCCO |
| InChI | InChI=1S/C6H10O3.C2H6O2.5C2H4/c1(5-3-8-5)7-2-6-4-9-6;3-1-2-4;5*1-2/h5-6H,1-4H2;3-4H,1-2H2;5*1-2H2 |
| InChIKey | SEHHBSHRALRYAP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|