C20H40O5 — CID 173030236
ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;tetrakis(prop-1-ene) (PubChem CID 173030236) has the molecular formula C20H40O5 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;tetrakis(prop-1-ene).
| Compound Name | ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;tetrakis(prop-1-ene) |
|---|---|
| PubChem CID | 173030236 |
| Molecular Formula | C20H40O5 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;tetrakis(prop-1-ene) |
| SMILES | C(OCC1CO1)C1CO1.C=CC.C=CC.C=CC.C=CC.OCCO |
| InChI | InChI=1S/C6H10O3.4C3H6.C2H6O2/c1(5-3-8-5)7-2-6-4-9-6;4*1-3-2;3-1-2-4/h5-6H,1-4H2;4*3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | NVRCUJGGIORQAK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|