C16H26O5 — CID 126511442
ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;1,4-xylene (PubChem CID 126511442) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;1,4-xylene.
| Compound Name | ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;1,4-xylene |
|---|---|
| PubChem CID | 126511442 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane;1,4-xylene |
| SMILES | C(OCC1CO1)C1CO1.Cc1ccc(C)cc1.OCCO |
| InChI | InChI=1S/C8H10.C6H10O3.C2H6O2/c1-7-3-5-8(2)6-4-7;1(5-3-8-5)7-2-6-4-9-6;3-1-2-4/h3-6H,1-2H3;5-6H,1-4H2;3-4H,1-2H2 |
| InChIKey | QLNXUHQKFLIGPW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|