C13H26O5 — CID 88518341
cyclopentane;ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 88518341) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is cyclopentane;ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | cyclopentane;ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 88518341 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | cyclopentane;ethane-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C1CCCC1.OCCO |
| InChI | InChI=1S/C6H10O3.C5H10.C2H6O2/c1(5-3-8-5)7-2-6-4-9-6;1-2-4-5-3-1;3-1-2-4/h5-6H,1-4H2;1-5H2;3-4H,1-2H2 |
| InChIKey | MABOIHSUCSRHHQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|