About cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane
cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87835873) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 87835873 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.OCC1CCCCC1 |
| InChI | InChI=1S/C7H14O.C6H10O3/c8-6-7-4-2-1-3-5-7;1(5-3-8-5)7-2-6-4-9-6/h7-8H,1-6H2;5-6H,1-4H2 |
| InChIKey | YLQPBCOXOOVPIM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 87835873) is cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.OCC1CCCCC1.
What is the InChIKey of cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is YLQPBCOXOOVPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C6H10O3/c8-6-7-4-2-1-3-5-7;1(5-3-8-5)7-2-6-4-9-6/h7-8H,1-6H2;5-6H,1-4H2.
What are the key properties of cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 244.33 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethanol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 87835873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).