C10H18O5 — CID 87871261
(Z)-but-2-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87871261) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (Z)-but-2-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | (Z)-but-2-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 87871261 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (Z)-but-2-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.OC/C=C\CO |
| InChI | InChI=1S/C6H10O3.C4H8O2/c1(5-3-8-5)7-2-6-4-9-6;5-3-1-2-4-6/h5-6H,1-4H2;1-2,5-6H,3-4H2/b;2-1- |
| InChIKey | QZVVBDYYJWYCSZ-BTJKTKAUSA-N |
| XLogP | -0.67 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|