About 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol
2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol (PubChem CID 22222974) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol |
| PubChem CID | 22222974 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol |
| SMILES | C(OCC1CO1)C1CO1.CCCO |
| InChI | InChI=1S/C6H10O3.C3H8O/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-4/h5-6H,1-4H2;4H,2-3H2,1H3 |
| InChIKey | YOAPFRFCAHQLCO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol (CID 22222974) is 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol is C(OCC1CO1)C1CO1.CCCO.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol?
The InChIKey is YOAPFRFCAHQLCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C3H8O/c1(5-3-8-5)7-2-6-4-9-6;1-2-3-4/h5-6H,1-4H2;4H,2-3H2,1H3.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol?
2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol has a molecular weight of 190.24 g/mol, XLogP of 0.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;propan-1-ol is sourced from PubChem (CID 22222974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).