About ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane
ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 135339306) has the molecular formula C12H26O7
and a molecular weight of 282.33 g/mol. Its IUPAC name is ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 135339306 |
| Molecular Formula | C12H26O7 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCO.OCCOCCO |
| InChI | InChI=1S/C6H10O3.C4H10O3.C2H6O/c1(5-3-8-5)7-2-6-4-9-6;5-1-3-7-4-2-6;1-2-3/h5-6H,1-4H2;5-6H,1-4H2;3H,2H2,1H3 |
| InChIKey | KBQMZULVMNINPS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 135339306) is ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CCO.OCCOCCO.
What is the InChIKey of ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is KBQMZULVMNINPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H10O3.C2H6O/c1(5-3-8-5)7-2-6-4-9-6;5-1-3-7-4-2-6;1-2-3/h5-6H,1-4H2;5-6H,1-4H2;3H,2H2,1H3.
What are the key properties of ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane?
ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 282.33 g/mol, XLogP of -1.21, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-(2-hydroxyethoxy)ethanol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 135339306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).