C20H26O4 — CID 174448667
benzene;2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174448667) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is benzene;2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | benzene;2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174448667 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | benzene;2,3-dimethylphenol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Cc1cccc(O)c1C.c1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H10O3.C6H6/c1-6-4-3-5-8(9)7(6)2;1(5-3-8-5)7-2-6-4-9-6;1-2-4-6-5-3-1/h3-5,9H,1-2H3;5-6H,1-4H2;1-6H |
| InChIKey | IXNBRYIUYOJMGZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|