About 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane
2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane (PubChem CID 162075720) has the molecular formula C12H17O3P
and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane |
| PubChem CID | 162075720 |
| Molecular Formula | C12H17O3P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane |
| SMILES | C(OCC1CO1)C1CO1.Pc1ccccc1 |
| InChI | InChI=1S/C6H10O3.C6H7P/c1(5-3-8-5)7-2-6-4-9-6;7-6-4-2-1-3-5-6/h5-6H,1-4H2;1-5H,7H2 |
| InChIKey | ZBRIGXIVQAVZRC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane (CID 162075720) is 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane is C(OCC1CO1)C1CO1.Pc1ccccc1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane?
The InChIKey is ZBRIGXIVQAVZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H7P/c1(5-3-8-5)7-2-6-4-9-6;7-6-4-2-1-3-5-6/h5-6H,1-4H2;1-5H,7H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane?
2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane has a molecular weight of 240.24 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;phenylphosphane is sourced from PubChem (CID 162075720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).