About aniline;2-(oxiran-2-ylmethoxymethyl)oxirane
aniline;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 158083266) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is aniline;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | aniline;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 158083266 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | aniline;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.Nc1ccccc1 |
| InChI | InChI=1S/C6H7N.C6H10O3/c7-6-4-2-1-3-5-6;1(5-3-8-5)7-2-6-4-9-6/h1-5H,7H2;5-6H,1-4H2 |
| InChIKey | FNFBFJMQUXIHSI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aniline;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of aniline;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 158083266) is aniline;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for aniline;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for aniline;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.Nc1ccccc1.
What is the InChIKey of aniline;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is FNFBFJMQUXIHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C6H10O3/c7-6-4-2-1-3-5-6;1(5-3-8-5)7-2-6-4-9-6/h1-5H,7H2;5-6H,1-4H2.
What are the key properties of aniline;2-(oxiran-2-ylmethoxymethyl)oxirane?
aniline;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 223.27 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 158083266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).