About nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane
nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 88773027) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 88773027 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H10O3/c8-7(9)6-4-2-1-3-5-6;1(5-3-8-5)7-2-6-4-9-6/h1-5H;5-6H,1-4H2 |
| InChIKey | BNJAHPRTRFBGJU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 88773027) is nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is BNJAHPRTRFBGJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H10O3/c8-7(9)6-4-2-1-3-5-6;1(5-3-8-5)7-2-6-4-9-6/h1-5H;5-6H,1-4H2.
What are the key properties of nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane?
nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 253.25 g/mol, XLogP of 1.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 88773027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).