About methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate
methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate (PubChem CID 158341331) has the molecular formula C19H22N2O12S2
and a molecular weight of 534.52 g/mol. Its IUPAC name is methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| PubChem CID | 158341331 |
| Molecular Formula | C19H22N2O12S2 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| SMILES | C.O=[N+]([O-])c1cccc(S(=O)(=O)OC[C@@H]2CO2)c1.O=[N+]([O-])c1cccc(S(=O)(=O)OC[C@H]2CO2)c1 |
| InChI | InChI=1S/2C9H9NO6S.CH4/c2*11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8;/h2*1-4,8H,5-6H2;1H4/t2*8-;/m10./s1 |
| InChIKey | GRESQXIDZGAINW-DCBBVGBMSA-N |
| XLogP | 2.03 |
| TPSA | 198.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The IUPAC name of methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate (CID 158341331) is methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate.
What is the SMILES notation for methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The canonical SMILES for methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate is C.O=[N+]([O-])c1cccc(S(=O)(=O)OC[C@@H]2CO2)c1.O=[N+]([O-])c1cccc(S(=O)(=O)OC[C@H]2CO2)c1.
What is the InChIKey of methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The InChIKey is GRESQXIDZGAINW-DCBBVGBMSA-N. The full InChI is InChI=1S/2C9H9NO6S.CH4/c2*11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8;/h2*1-4,8H,5-6H2;1H4/t2*8-;/m10./s1.
What are the key properties of methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate?
methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate has a molecular weight of 534.52 g/mol, XLogP of 2.03, 10 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(2S)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate;[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate is sourced from PubChem (CID 158341331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).