C11H10N2O9S — CID 155338217
(5R)-5-[(3-nitrophenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidine-3-carboxylic acid (PubChem CID 155338217) has the molecular formula C11H10N2O9S and a molecular weight of 346.27 g/mol. Its IUPAC name is (5R)-5-[(3-nitrophenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (5R)-5-[(3-nitrophenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155338217 |
| Molecular Formula | C11H10N2O9S |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (5R)-5-[(3-nitrophenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidine-3-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](COS(=O)(=O)c2cccc([N+](=O)[O-])c2)OC1=O |
| InChI | InChI=1S/C11H10N2O9S/c14-10(15)12-5-8(22-11(12)16)6-21-23(19,20)9-3-1-2-7(4-9)13(17)18/h1-4,8H,5-6H2,(H,14,15)/t8-/m1/s1 |
| InChIKey | VPCZWUHURQTCDW-MRVPVSSYSA-N |
| XLogP | 0.80 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|